C21H21NO2 — CID 135035621
[(2S,3R)-2-phenyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]methyl acetate (PubChem CID 135035621) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(2S,3R)-2-phenyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]methyl acetate.
| Compound Name | [(2S,3R)-2-phenyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 135035621 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | [(2S,3R)-2-phenyl-2,3,4,9-tetrahydro-1H-carbazol-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1Cc2c([nH]c3ccccc23)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21NO2/c1-14(23)24-13-16-11-19-17-9-5-6-10-20(17)22-21(19)12-18(16)15-7-3-2-4-8-15/h2-10,16,18,22H,11-13H2,1H3/t16-,18+/m0/s1 |
| InChIKey | JWUXSFLDJHFREJ-FUHWJXTLSA-N |
| XLogP | 4.23 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|