C23H24N2O2 — CID 154836302
6-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 154836302) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 6-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 154836302 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-(3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(C(=O)N3CC(c4ccccc4)C4CCCC43)ccc2N1 |
| InChI | InChI=1S/C23H24N2O2/c26-22-12-10-16-13-17(9-11-20(16)24-22)23(27)25-14-19(15-5-2-1-3-6-15)18-7-4-8-21(18)25/h1-3,5-6,9,11,13,18-19,21H,4,7-8,10,12,14H2,(H,24,26) |
| InChIKey | UTGVSTMQPVXEQF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |