C10H20N2O2S2 — CID 124738652
1-(3-ethylsulfanylpropyl)-3-[(1S,3R)-1-oxothiolan-3-yl]urea (PubChem CID 124738652) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 1-(3-ethylsulfanylpropyl)-3-[(1S,3R)-1-oxothiolan-3-yl]urea.
| Compound Name | 1-(3-ethylsulfanylpropyl)-3-[(1S,3R)-1-oxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 124738652 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(3-ethylsulfanylpropyl)-3-[(1S,3R)-1-oxothiolan-3-yl]urea |
| SMILES | CCSCCCNC(=O)N[C@@H]1CC[S@](=O)C1 |
| InChI | InChI=1S/C10H20N2O2S2/c1-2-15-6-3-5-11-10(13)12-9-4-7-16(14)8-9/h9H,2-8H2,1H3,(H2,11,12,13)/t9-,16+/m1/s1 |
| InChIKey | RNBVWLMSOSVNOL-ABKXIKBNSA-N |
| XLogP | 0.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|