C20H23N3O2 — CID 124738838
[(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-pyridin-3-yloxyphenyl)methanone (PubChem CID 124738838) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-pyridin-3-yloxyphenyl)methanone.
| Compound Name | [(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-pyridin-3-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 124738838 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [(3R,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-pyridin-3-yloxyphenyl)methanone |
| SMILES | C[C@@H]1CN2CCC[C@H]2CN1C(=O)c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-15-13-22-11-3-4-17(22)14-23(15)20(24)16-6-8-18(9-7-16)25-19-5-2-10-21-12-19/h2,5-10,12,15,17H,3-4,11,13-14H2,1H3/t15-,17+/m1/s1 |
| InChIKey | RSGGQYRWUTZGGN-WBVHZDCISA-N |
| XLogP | 3.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |