C19H23N3O2 — CID 124740313
1-[2-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]quinoxalin-2-one (PubChem CID 124740313) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[2-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]quinoxalin-2-one.
| Compound Name | 1-[2-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 124740313 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-[2-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2-oxoethyl]quinoxalin-2-one |
| SMILES | C[C@@H]1C[C@H]2CCCC[C@H]2N1C(=O)Cn1c(=O)cnc2ccccc21 |
| InChI | InChI=1S/C19H23N3O2/c1-13-10-14-6-2-4-8-16(14)22(13)19(24)12-21-17-9-5-3-7-15(17)20-11-18(21)23/h3,5,7,9,11,13-14,16H,2,4,6,8,10,12H2,1H3/t13-,14-,16-/m1/s1 |
| InChIKey | UNTUYOPKKSJNRR-IIAWOOMASA-N |
| XLogP | 2.58 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |