C17H26N2O3S — CID 124740462
(3R,4R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-ethyl-1-methylsulfonylpiperidin-4-amine (PubChem CID 124740462) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is (3R,4R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-ethyl-1-methylsulfonylpiperidin-4-amine.
| Compound Name | (3R,4R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-ethyl-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 124740462 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3R,4R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-3-ethyl-1-methylsulfonylpiperidin-4-amine |
| SMILES | CC[C@@H]1CN(S(C)(=O)=O)CC[C@H]1NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H26N2O3S/c1-3-14-12-19(23(2,20)21)8-6-16(14)18-11-13-4-5-17-15(10-13)7-9-22-17/h4-5,10,14,16,18H,3,6-9,11-12H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | UTIKFYSCXWOELP-GDBMZVCRSA-N |
| XLogP | 1.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|