C19H25N3O2 — CID 128973879
(2R,3S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine (PubChem CID 128973879) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (2R,3S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine.
| Compound Name | (2R,3S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 128973879 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (2R,3S)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-2-(1,3,5-trimethylpyrazol-4-yl)oxolan-3-amine |
| SMILES | Cc1nn(C)c(C)c1[C@H]1OCC[C@@H]1NCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C19H25N3O2/c1-12-18(13(2)22(3)21-12)19-16(7-9-24-19)20-11-14-4-5-17-15(10-14)6-8-23-17/h4-5,10,16,19-20H,6-9,11H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | HUWNEGMZBINDTP-LPHOPBHVSA-N |
| XLogP | 2.59 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|