C16H20N2O — CID 115150163
4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclohexane-1-carbonitrile (PubChem CID 115150163) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclohexane-1-carbonitrile.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 115150163 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(NCc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C16H20N2O/c17-10-12-1-4-15(5-2-12)18-11-13-3-6-16-14(9-13)7-8-19-16/h3,6,9,12,15,18H,1-2,4-5,7-8,11H2 |
| InChIKey | ZYVGILPLQSQQBU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|