C18H20Cl2N4O3S — CID 124741053
2,3-dichloro-5-[(3R)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylpyridine (PubChem CID 124741053) has the molecular formula C18H20Cl2N4O3S and a molecular weight of 443.36 g/mol. Its IUPAC name is 2,3-dichloro-5-[(3R)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylpyridine.
| Compound Name | 2,3-dichloro-5-[(3R)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 124741053 |
| Molecular Formula | C18H20Cl2N4O3S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2,3-dichloro-5-[(3R)-3-[(2-pyrrolidin-1-yl-3-pyridinyl)oxy]pyrrolidin-1-yl]sulfonylpyridine |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CC[C@@H](Oc2cccnc2N2CCCC2)C1 |
| InChI | InChI=1S/C18H20Cl2N4O3S/c19-15-10-14(11-22-17(15)20)28(25,26)24-9-5-13(12-24)27-16-4-3-6-21-18(16)23-7-1-2-8-23/h3-4,6,10-11,13H,1-2,5,7-9,12H2/t13-/m1/s1 |
| InChIKey | VROVITOSNQCWAY-CYBMUJFWSA-N |
| XLogP | 3.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|