C19H21N3O3S2 — CID 124741959
N-[(2S)-2-morpholin-4-yl-2-phenylethyl]-1,3-benzothiazole-4-sulfonamide (PubChem CID 124741959) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(2S)-2-morpholin-4-yl-2-phenylethyl]-1,3-benzothiazole-4-sulfonamide.
| Compound Name | N-[(2S)-2-morpholin-4-yl-2-phenylethyl]-1,3-benzothiazole-4-sulfonamide |
|---|---|
| PubChem CID | 124741959 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[(2S)-2-morpholin-4-yl-2-phenylethyl]-1,3-benzothiazole-4-sulfonamide |
| SMILES | O=S(=O)(NC[C@H](c1ccccc1)N1CCOCC1)c1cccc2scnc12 |
| InChI | InChI=1S/C19H21N3O3S2/c23-27(24,18-8-4-7-17-19(18)20-14-26-17)21-13-16(15-5-2-1-3-6-15)22-9-11-25-12-10-22/h1-8,14,16,21H,9-13H2/t16-/m1/s1 |
| InChIKey | XBCVBPDASKAHPI-MRXNPFEDSA-N |
| XLogP | 2.65 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |