C17H19ClN2O4S2 — CID 124742673
2-chloro-N-methyl-N-[(1R)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]-4-sulfamoylbenzamide (PubChem CID 124742673) has the molecular formula C17H19ClN2O4S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[(1R)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]-4-sulfamoylbenzamide.
| Compound Name | 2-chloro-N-methyl-N-[(1R)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 124742673 |
| Molecular Formula | C17H19ClN2O4S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-chloro-N-methyl-N-[(1R)-1-[4-[(R)-methylsulfinyl]phenyl]ethyl]-4-sulfamoylbenzamide |
| SMILES | C[C@H](c1ccc([S@@](C)=O)cc1)N(C)C(=O)c1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O4S2/c1-11(12-4-6-13(7-5-12)25(3)22)20(2)17(21)15-9-8-14(10-16(15)18)26(19,23)24/h4-11H,1-3H3,(H2,19,23,24)/t11-,25-/m1/s1 |
| InChIKey | YEMXTSVNUMEDGD-SSINHNECSA-N |
| XLogP | 2.56 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |