C13H26N2 — CID 124746802
(1S,2R,5R)-2-methyl-7-pentyl-3,7-diazabicyclo[3.3.1]nonane (PubChem CID 124746802) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (1S,2R,5R)-2-methyl-7-pentyl-3,7-diazabicyclo[3.3.1]nonane.
| Compound Name | (1S,2R,5R)-2-methyl-7-pentyl-3,7-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 124746802 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (1S,2R,5R)-2-methyl-7-pentyl-3,7-diazabicyclo[3.3.1]nonane |
| SMILES | CCCCCN1C[C@H]2CN[C@H](C)[C@@H](C2)C1 |
| InChI | InChI=1S/C13H26N2/c1-3-4-5-6-15-9-12-7-13(10-15)11(2)14-8-12/h11-14H,3-10H2,1-2H3/t11-,12-,13+/m1/s1 |
| InChIKey | NRFXECJVXVXGFW-UPJWGTAASA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|