C30H31Cl3O7 — CID 124746957
(2S,3aS,5R,6S,7R,7aR)-6,7-bis[(4-chlorophenyl)methoxy]-5-[(4-chlorophenyl)methoxymethyl]-2-methoxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 124746957) has the molecular formula C30H31Cl3O7 and a molecular weight of 609.93 g/mol. Its IUPAC name is (2S,3aS,5R,6S,7R,7aR)-6,7-bis[(4-chlorophenyl)methoxy]-5-[(4-chlorophenyl)methoxymethyl]-2-methoxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (2S,3aS,5R,6S,7R,7aR)-6,7-bis[(4-chlorophenyl)methoxy]-5-[(4-chlorophenyl)methoxymethyl]-2-methoxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 124746957 |
| Molecular Formula | C30H31Cl3O7 |
| Molecular Weight | 609.93 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | (2S,3aS,5R,6S,7R,7aR)-6,7-bis[(4-chlorophenyl)methoxy]-5-[(4-chlorophenyl)methoxymethyl]-2-methoxy-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | CO[C@]1(C)O[C@@H]2O[C@H](COCc3ccc(Cl)cc3)[C@H](OCc3ccc(Cl)cc3)[C@@H](OCc3ccc(Cl)cc3)[C@H]2O1 |
| InChI | InChI=1S/C30H31Cl3O7/c1-30(34-2)39-28-27(37-17-21-7-13-24(33)14-8-21)26(36-16-20-5-11-23(32)12-6-20)25(38-29(28)40-30)18-35-15-19-3-9-22(31)10-4-19/h3-14,25-29H,15-18H2,1-2H3/t25-,26+,27-,28-,29+,30+/m1/s1 |
| InChIKey | OQCBMIBQRLNIFF-KWKLTRBOSA-N |
| XLogP | 6.79 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.93 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |