C38H39ClO6 — CID 102127280
1-[(2S,3S,4R,5R,6R)-2-(4-chlorophenyl)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-yl]ethanone (PubChem CID 102127280) has the molecular formula C38H39ClO6 and a molecular weight of 627.18 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R,6R)-2-(4-chlorophenyl)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-yl]ethanone.
| Compound Name | 1-[(2S,3S,4R,5R,6R)-2-(4-chlorophenyl)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-yl]ethanone |
|---|---|
| PubChem CID | 102127280 |
| Molecular Formula | C38H39ClO6 |
| Molecular Weight | 627.18 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 1-[(2S,3S,4R,5R,6R)-2-(4-chlorophenyl)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1C2C(O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)O[C@]1(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C38H39ClO6/c1-26(40)34-33-36(43-24-29-16-10-5-11-17-29)35(42-23-28-14-8-4-9-15-28)32(25-41-22-27-12-6-3-7-13-27)44-37(33)45-38(34,2)30-18-20-31(39)21-19-30/h3-21,32-37H,22-25H2,1-2H3/t32-,33?,34+,35+,36?,37?,38-/m1/s1 |
| InChIKey | HPZSKNBDZFEVLB-MXTPADAYSA-N |
| XLogP | 7.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.18 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |