C38H40O6 — CID 134948382
2-[(2R,3aR,4R,5S,6R,7aR)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-yl]-1-phenylethanone (PubChem CID 134948382) has the molecular formula C38H40O6 and a molecular weight of 592.73 g/mol. Its IUPAC name is 2-[(2R,3aR,4R,5S,6R,7aR)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-yl]-1-phenylethanone.
| Compound Name | 2-[(2R,3aR,4R,5S,6R,7aR)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 134948382 |
| Molecular Formula | C38H40O6 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[(2R,3aR,4R,5S,6R,7aR)-2-methyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-2-yl]-1-phenylethanone |
| SMILES | C[C@]1(CC(=O)c2ccccc2)C[C@H]2[C@H](O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C38H40O6/c1-38(23-33(39)31-20-12-5-13-21-31)22-32-35(41-25-29-16-8-3-9-17-29)36(42-26-30-18-10-4-11-19-30)34(43-37(32)44-38)27-40-24-28-14-6-2-7-15-28/h2-21,32,34-37H,22-27H2,1H3/t32-,34-,35-,36-,37-,38-/m1/s1 |
| InChIKey | RAVCYDUUOYDYSX-ZUKARJAYSA-N |
| XLogP | 7.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |