C17H24N2O3 — CID 124755306
1-(3-methoxyphenyl)-4-[[(3R)-oxan-3-yl]methyl]piperazin-2-one (PubChem CID 124755306) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-[[(3R)-oxan-3-yl]methyl]piperazin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-4-[[(3R)-oxan-3-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 124755306 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-[[(3R)-oxan-3-yl]methyl]piperazin-2-one |
| SMILES | COc1cccc(N2CCN(C[C@H]3CCCOC3)CC2=O)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-21-16-6-2-5-15(10-16)19-8-7-18(12-17(19)20)11-14-4-3-9-22-13-14/h2,5-6,10,14H,3-4,7-9,11-13H2,1H3/t14-/m1/s1 |
| InChIKey | QCCIUAVKZHISEC-CQSZACIVSA-N |
| XLogP | 1.77 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |