C19H17ClN4O4 — CID 124756534
(7S)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-7-hydroxy-4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide (PubChem CID 124756534) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is (7S)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-7-hydroxy-4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide.
| Compound Name | (7S)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-7-hydroxy-4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 124756534 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (7S)-N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-7-hydroxy-4-oxo-5,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
| SMILES | O=C(NCc1ccc(-c2cccc(Cl)c2)o1)c1cc2n(n1)C[C@@H](O)CNC2=O |
| InChI | InChI=1S/C19H17ClN4O4/c20-12-3-1-2-11(6-12)17-5-4-14(28-17)9-22-18(26)15-7-16-19(27)21-8-13(25)10-24(16)23-15/h1-7,13,25H,8-10H2,(H,21,27)(H,22,26)/t13-/m0/s1 |
| InChIKey | SVOWLGWSAKJRKP-ZDUSSCGKSA-N |
| XLogP | 1.83 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |