C12H11Cl2N5O — CID 163328000
N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2H-tetrazol-5-amine;hydrochloride (PubChem CID 163328000) has the molecular formula C12H11Cl2N5O and a molecular weight of 312.16 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2H-tetrazol-5-amine;hydrochloride.
| Compound Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2H-tetrazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 163328000 |
| Molecular Formula | C12H11Cl2N5O |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-2H-tetrazol-5-amine;hydrochloride |
| SMILES | Cl.Clc1cccc(-c2ccc(CNc3nn[nH]n3)o2)c1 |
| InChI | InChI=1S/C12H10ClN5O.ClH/c13-9-3-1-2-8(6-9)11-5-4-10(19-11)7-14-12-15-17-18-16-12;/h1-6H,7H2,(H2,14,15,16,17,18);1H |
| InChIKey | MUCVTSVRBYHXRR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |