C29H31NO7S — CID 124762969
N-[3-[(4aR,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 124762969) has the molecular formula C29H31NO7S and a molecular weight of 537.63 g/mol. Its IUPAC name is N-[3-[(4aR,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[3-[(4aR,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 124762969 |
| Molecular Formula | C29H31NO7S |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | N-[3-[(4aR,6S,10bS)-7,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c]chromen-6-yl]phenyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | COc1ccc(OC)c2c1[C@H](c1cccc(NS(=O)(=O)c3ccc4c(c3)OCCO4)c1)O[C@@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C29H31NO7S/c1-33-24-12-13-25(34-2)28-27(24)21-8-3-4-9-22(21)37-29(28)18-6-5-7-19(16-18)30-38(31,32)20-10-11-23-26(17-20)36-15-14-35-23/h5-7,10-13,16-17,21-22,29-30H,3-4,8-9,14-15H2,1-2H3/t21-,22-,29+/m1/s1 |
| InChIKey | JVQKSUQLLRSLAI-QLVXXPONSA-N |
| XLogP | 5.42 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |