C19H25N5O3S — CID 124763342
(6S,7R)-6-(4-ethoxyphenyl)-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide (PubChem CID 124763342) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is (6S,7R)-6-(4-ethoxyphenyl)-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide.
| Compound Name | (6S,7R)-6-(4-ethoxyphenyl)-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 124763342 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | (6S,7R)-6-(4-ethoxyphenyl)-3-methyl-N-[[(2R)-oxolan-2-yl]methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-7-carboxamide |
| SMILES | CCOc1ccc([C@@H]2Nn3c(C)nnc3S[C@H]2C(=O)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H25N5O3S/c1-3-26-14-8-6-13(7-9-14)16-17(18(25)20-11-15-5-4-10-27-15)28-19-22-21-12(2)24(19)23-16/h6-9,15-17,23H,3-5,10-11H2,1-2H3,(H,20,25)/t15-,16+,17-/m1/s1 |
| InChIKey | IQVCONWCCGJZIR-IXDOHACOSA-N |
| XLogP | 2.04 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |