C25H29N3O4 — CID 124766176
(1S,2R,5R,6S,7R)-2-N-cyclopentyl-6-N-cyclopropyl-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124766176) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R)-2-N-cyclopentyl-6-N-cyclopropyl-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7R)-2-N-cyclopentyl-6-N-cyclopropyl-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124766176 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (1S,2R,5R,6S,7R)-2-N-cyclopentyl-6-N-cyclopropyl-3-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3[C@H](C(=O)NC4CC4)[C@H]4C=C[C@@]3(O4)[C@@H]2C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C25H29N3O4/c1-14-5-4-8-17(13-14)28-21(23(30)27-15-6-2-3-7-15)25-12-11-18(32-25)19(20(25)24(28)31)22(29)26-16-9-10-16/h4-5,8,11-13,15-16,18-21H,2-3,6-7,9-10H2,1H3,(H,26,29)(H,27,30)/t18-,19-,20+,21+,25+/m1/s1 |
| InChIKey | URIUFZZOHPBRSB-BHQAQYLNSA-N |
| XLogP | 1.99 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|