C31H30N2O8 — CID 124766770
ethyl (2S,6S,8S,12S)-4,10-bis(2-methoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 124766770) has the molecular formula C31H30N2O8 and a molecular weight of 558.59 g/mol. Its IUPAC name is ethyl (2S,6S,8S,12S)-4,10-bis(2-methoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (2S,6S,8S,12S)-4,10-bis(2-methoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 124766770 |
| Molecular Formula | C31H30N2O8 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | ethyl (2S,6S,8S,12S)-4,10-bis(2-methoxyphenyl)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2[C@@H]3C(=O)N(c4ccccc4OC)C(=O)[C@@H]3C1(C)[C@H]1C(=O)N(c3ccccc3OC)C(=O)[C@@H]21 |
| InChI | InChI=1S/C31H30N2O8/c1-6-41-30(38)23-15(2)20-21-24(28(36)32(26(21)34)16-11-7-9-13-18(16)39-4)31(23,3)25-22(20)27(35)33(29(25)37)17-12-8-10-14-19(17)40-5/h7-14,20-22,24-25H,6H2,1-5H3/t20?,21-,22-,24+,25+,31?/m0/s1 |
| InChIKey | RHHIVWFRQKBGHI-JTXUKWTJSA-N |
| XLogP | 3.14 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|