C35H38N2O8 — CID 162809093
ethyl (6R,8S,12S)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-bis(2-propoxyphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 162809093) has the molecular formula C35H38N2O8 and a molecular weight of 614.70 g/mol. Its IUPAC name is ethyl (6R,8S,12S)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-bis(2-propoxyphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl (6R,8S,12S)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-bis(2-propoxyphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 162809093 |
| Molecular Formula | C35H38N2O8 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | ethyl (6R,8S,12S)-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-bis(2-propoxyphenyl)-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCCOc1ccccc1N1C(=O)C2[C@H](C1=O)C1C(C)=C(C(=O)OCC)C2(C)[C@H]2C(=O)N(c3ccccc3OCCC)C(=O)[C@@H]12 |
| InChI | InChI=1S/C35H38N2O8/c1-6-17-44-22-15-11-9-13-20(22)36-30(38)25-24-19(4)27(34(42)43-8-3)35(5,28(25)32(36)40)29-26(24)31(39)37(33(29)41)21-14-10-12-16-23(21)45-18-7-2/h9-16,24-26,28-29H,6-8,17-18H2,1-5H3/t24?,25-,26+,28+,29?,35?/m0/s1 |
| InChIKey | KOQDRQBIGYHNHJ-FHHNBATNSA-N |
| XLogP | 4.70 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|