C18H20N2O6S — CID 124767305
(2S,3S,4R,5R,6S)-2-methyl-6-(3-nitro-5-phenylsulfanylanilino)oxane-3,4,5-triol (PubChem CID 124767305) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-2-methyl-6-(3-nitro-5-phenylsulfanylanilino)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6S)-2-methyl-6-(3-nitro-5-phenylsulfanylanilino)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 124767305 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2S,3S,4R,5R,6S)-2-methyl-6-(3-nitro-5-phenylsulfanylanilino)oxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@H](Nc2cc(Sc3ccccc3)cc([N+](=O)[O-])c2)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20N2O6S/c1-10-15(21)16(22)17(23)18(26-10)19-11-7-12(20(24)25)9-14(8-11)27-13-5-3-2-4-6-13/h2-10,15-19,21-23H,1H3/t10-,15+,16+,17+,18-/m0/s1 |
| InChIKey | FLTTUASWHSPFOB-NKEQUCRHSA-N |
| XLogP | 1.99 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|