C27H22N2O5S2 — CID 124767470
2-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-5,9-diphenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid (PubChem CID 124767470) has the molecular formula C27H22N2O5S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-5,9-diphenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid.
| Compound Name | 2-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-5,9-diphenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
|---|---|
| PubChem CID | 124767470 |
| Molecular Formula | C27H22N2O5S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 2-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-5,9-diphenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@H](c2ccccc2)c2sc(=O)n(-c4ccccc4)c2S[C@H]31 |
| InChI | InChI=1S/C27H22N2O5S2/c30-17(31)12-28-24(32)20-15-11-16(21(20)25(28)33)22-19(15)18(13-7-3-1-4-8-13)23-26(35-22)29(27(34)36-23)14-9-5-2-6-10-14/h1-10,15-16,18-22H,11-12H2,(H,30,31)/t15-,16-,18+,19-,20+,21-,22-/m1/s1 |
| InChIKey | QCZWUQBVWMEHDX-GQSCFXBNSA-N |
| XLogP | 3.46 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|