C25H19NO5S2 — CID 98146562
(1R,2S,9S,10S,11R,12R,16S)-9-(2-hydroxyphenyl)-5-phenyl-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 98146562) has the molecular formula C25H19NO5S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is (1R,2S,9S,10S,11R,12R,16S)-9-(2-hydroxyphenyl)-5-phenyl-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2S,9S,10S,11R,12R,16S)-9-(2-hydroxyphenyl)-5-phenyl-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 98146562 |
| Molecular Formula | C25H19NO5S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | (1R,2S,9S,10S,11R,12R,16S)-9-(2-hydroxyphenyl)-5-phenyl-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]3C[C@H]([C@@H]12)[C@H]1[C@@H](c2ccccc2O)c2sc(=O)n(-c4ccccc4)c2S[C@@H]31 |
| InChI | InChI=1S/C25H19NO5S2/c27-15-9-5-4-8-12(15)16-17-13-10-14(19-18(13)23(28)31-24(19)29)20(17)32-22-21(16)33-25(30)26(22)11-6-2-1-3-7-11/h1-9,13-14,16-20,27H,10H2/t13-,14+,16+,17-,18+,19+,20-/m0/s1 |
| InChIKey | ARUMZEVBQXCFRH-DDPUJGDSSA-N |
| XLogP | 3.79 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|