C20H12NO5S2- — CID 7112327
(1S,10S,11R)-9,15-dioxo-14-phenyl-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate (PubChem CID 7112327) has the molecular formula C20H12NO5S2- and a molecular weight of 410.45 g/mol. Its IUPAC name is (1S,10S,11R)-9,15-dioxo-14-phenyl-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate.
| Compound Name | (1S,10S,11R)-9,15-dioxo-14-phenyl-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 7112327 |
| Molecular Formula | C20H12NO5S2- |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | (1S,10S,11R)-9,15-dioxo-14-phenyl-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
| SMILES | O=C1Oc2ccccc2[C@H]2c3sc(=O)n(-c4ccccc4)c3S[C@@H](C(=O)[O-])[C@H]12 |
| InChI | InChI=1S/C20H13NO5S2/c22-18(23)16-14-13(11-8-4-5-9-12(11)26-19(14)24)15-17(27-16)21(20(25)28-15)10-6-2-1-3-7-10/h1-9,13-14,16H,(H,22,23)/p-1/t13-,14-,16-/m1/s1 |
| InChIKey | MMSQLYKMBQRQFM-IIAWOOMASA-M |
| XLogP | 1.79 |
| TPSA | 88.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|