C23H22N2O5S3 — CID 18865543
ethyl 2-[9-(2-hydroxyphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 18865543) has the molecular formula C23H22N2O5S3 and a molecular weight of 502.64 g/mol. Its IUPAC name is ethyl 2-[9-(2-hydroxyphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | ethyl 2-[9-(2-hydroxyphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 18865543 |
| Molecular Formula | C23H22N2O5S3 |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | ethyl 2-[9-(2-hydroxyphenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2ccccc2O)c2sc(=S)[nH]c2SC31 |
| InChI | InChI=1S/C23H22N2O5S3/c1-2-30-13(27)8-25-21(28)16-10-7-11(17(16)22(25)29)18-15(10)14(9-5-3-4-6-12(9)26)19-20(32-18)24-23(31)33-19/h3-6,10-11,14-18,26H,2,7-8H2,1H3,(H,24,31) |
| InChIKey | HPWPFNIFSZBEGP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|