C23H20Cl2N2O4S3 — CID 18865547
ethyl 2-[9-(2,3-dichlorophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 18865547) has the molecular formula C23H20Cl2N2O4S3 and a molecular weight of 555.53 g/mol. Its IUPAC name is ethyl 2-[9-(2,3-dichlorophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | ethyl 2-[9-(2,3-dichlorophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 18865547 |
| Molecular Formula | C23H20Cl2N2O4S3 |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 554.00 |
| IUPAC Name | ethyl 2-[9-(2,3-dichlorophenyl)-13,15-dioxo-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(Cl)c2Cl)c2sc(=S)[nH]c2SC31 |
| InChI | InChI=1S/C23H20Cl2N2O4S3/c1-2-31-12(28)7-27-21(29)15-9-6-10(16(15)22(27)30)18-14(9)13(8-4-3-5-11(24)17(8)25)19-20(33-18)26-23(32)34-19/h3-5,9-10,13-16,18H,2,6-7H2,1H3,(H,26,32) |
| InChIKey | KWUPETLLGZTNPA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|