C26H20BrNO5S2 — CID 98170758
(1R,2S,9R,10R,11R,12R,16S)-5-benzyl-9-(5-bromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 98170758) has the molecular formula C26H20BrNO5S2 and a molecular weight of 570.49 g/mol. Its IUPAC name is (1R,2S,9R,10R,11R,12R,16S)-5-benzyl-9-(5-bromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2S,9R,10R,11R,12R,16S)-5-benzyl-9-(5-bromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 98170758 |
| Molecular Formula | C26H20BrNO5S2 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 569.00 |
| IUPAC Name | (1R,2S,9R,10R,11R,12R,16S)-5-benzyl-9-(5-bromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]3C[C@H]([C@@H]12)[C@@H]1[C@H](c2cc(Br)ccc2O)c2sc(=O)n(Cc4ccccc4)c2S[C@@H]31 |
| InChI | InChI=1S/C26H20BrNO5S2/c27-12-6-7-16(29)13(8-12)17-18-14-9-15(20-19(14)24(30)33-25(20)31)21(18)34-23-22(17)35-26(32)28(23)10-11-4-2-1-3-5-11/h1-8,14-15,17-21,29H,9-10H2/t14-,15+,17-,18+,19+,20+,21-/m0/s1 |
| InChIKey | URKSBJJTARWMOF-SKXRWJGOSA-N |
| XLogP | 4.61 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|