C24H22N2O5 — CID 124770969
(10S,11R,15S,16R)-16-acetyl-5-methoxy-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 124770969) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is (10S,11R,15S,16R)-16-acetyl-5-methoxy-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10S,11R,15S,16R)-16-acetyl-5-methoxy-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 124770969 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (10S,11R,15S,16R)-16-acetyl-5-methoxy-13-(4-methoxyphenyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H](C(C)=O)N2c4ccc(OC)cc4C=C[C@@H]32)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-13(27)22-21-20(19-10-4-14-12-17(31-3)9-11-18(14)26(19)22)23(28)25(24(21)29)15-5-7-16(30-2)8-6-15/h4-12,19-22H,1-3H3/t19-,20-,21-,22-/m0/s1 |
| InChIKey | BMVXYLWZOGBKRZ-CMOCDZPBSA-N |
| XLogP | 2.68 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|