C25H22N2O6 — CID 124773794
[4-[(10R,11R,15S,16R)-16-acetyl-5-methoxy-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-13-yl]phenyl] acetate (PubChem CID 124773794) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is [4-[(10R,11R,15S,16R)-16-acetyl-5-methoxy-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-13-yl]phenyl] acetate.
| Compound Name | [4-[(10R,11R,15S,16R)-16-acetyl-5-methoxy-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-13-yl]phenyl] acetate |
|---|---|
| PubChem CID | 124773794 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [4-[(10R,11R,15S,16R)-16-acetyl-5-methoxy-12,14-dioxo-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraen-13-yl]phenyl] acetate |
| SMILES | COc1ccc2c(c1)C=C[C@@H]1[C@@H]3C(=O)N(c4ccc(OC(C)=O)cc4)C(=O)[C@@H]3[C@H](C(C)=O)N21 |
| InChI | InChI=1S/C25H22N2O6/c1-13(28)23-22-21(20-10-4-15-12-18(32-3)9-11-19(15)27(20)23)24(30)26(25(22)31)16-5-7-17(8-6-16)33-14(2)29/h4-12,20-23H,1-3H3/t20-,21+,22+,23+/m1/s1 |
| InChIKey | OHJZXWILKAGHBT-LDVJMBRRSA-N |
| XLogP | 2.60 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|