C19H24N2O4 — CID 124781145
(3S,4aS,8aR)-N-(furan-2-ylmethyl)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 124781145) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (3S,4aS,8aR)-N-(furan-2-ylmethyl)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3S,4aS,8aR)-N-(furan-2-ylmethyl)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124781145 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3S,4aS,8aR)-N-(furan-2-ylmethyl)-6-(furan-3-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@@H]1CO[C@@H]2CCN(Cc3ccoc3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H24N2O4/c22-19(20-9-17-2-1-6-24-17)16-8-15-11-21(5-3-18(15)25-13-16)10-14-4-7-23-12-14/h1-2,4,6-7,12,15-16,18H,3,5,8-11,13H2,(H,20,22)/t15-,16-,18+/m0/s1 |
| InChIKey | BJCXUNLJNADMCK-XYJFISCASA-N |
| XLogP | 2.42 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |