C17H20N4O2S — CID 124781282
(3aS,7aS)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide (PubChem CID 124781282) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (3aS,7aS)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide.
| Compound Name | (3aS,7aS)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
|---|---|
| PubChem CID | 124781282 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3aS,7aS)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@]12CCO[C@H]1CCN(c1ncccn1)C2 |
| InChI | InChI=1S/C17H20N4O2S/c22-15(20-11-13-3-1-10-24-13)17-5-9-23-14(17)4-8-21(12-17)16-18-6-2-7-19-16/h1-3,6-7,10,14H,4-5,8-9,11-12H2,(H,20,22)/t14-,17-/m0/s1 |
| InChIKey | DOEVAIBWCCUUMT-YOEHRIQHSA-N |
| XLogP | 1.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |