C20H23F3N4O4S — CID 155861806
(4R,4aS,8aR)-6-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155861806) has the molecular formula C20H23F3N4O4S and a molecular weight of 472.49 g/mol. Its IUPAC name is (4R,4aS,8aR)-6-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aS,8aR)-6-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861806 |
| Molecular Formula | C20H23F3N4O4S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (4R,4aS,8aR)-6-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cccs1)[C@@H]1CCO[C@@H]2CCN(c3ncccn3)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H22N4O2S.C2HF3O2/c23-17(21-11-13-3-1-10-25-13)14-5-9-24-16-4-8-22(12-15(14)16)18-19-6-2-7-20-18;3-2(4,5)1(6)7/h1-3,6-7,10,14-16H,4-5,8-9,11-12H2,(H,21,23);(H,6,7)/t14-,15-,16-;/m1./s1 |
| InChIKey | RLDRLGOAQDMHNC-UDHFTORSSA-N |
| XLogP | 2.72 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |