C14H21ClN2O2S — CID 155852049
(4R,4aS,8aR)-N-(thiophen-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridine-4-carboxamide;hydrochloride (PubChem CID 155852049) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is (4R,4aS,8aR)-N-(thiophen-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridine-4-carboxamide;hydrochloride.
| Compound Name | (4R,4aS,8aR)-N-(thiophen-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155852049 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (4R,4aS,8aR)-N-(thiophen-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-pyrano[3,2-c]pyridine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCc1cccs1)[C@@H]1CCO[C@@H]2CCNC[C@@H]21 |
| InChI | InChI=1S/C14H20N2O2S.ClH/c17-14(16-8-10-2-1-7-19-10)11-4-6-18-13-3-5-15-9-12(11)13;/h1-2,7,11-13,15H,3-6,8-9H2,(H,16,17);1H/t11-,12-,13-;/m1./s1 |
| InChIKey | HMJKUOJUXWUQBN-NLPVPVDASA-N |
| XLogP | 1.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |