C13H14NO4S- — CID 3681927
3-(thiophen-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 3681927) has the molecular formula C13H14NO4S- and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 3-(thiophen-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 3681927 |
| Molecular Formula | C13H14NO4S- |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 3-(thiophen-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C([O-])C1C2CCC(O2)C1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C13H15NO4S/c15-12(14-6-7-2-1-5-19-7)10-8-3-4-9(18-8)11(10)13(16)17/h1-2,5,8-11H,3-4,6H2,(H,14,15)(H,16,17)/p-1 |
| InChIKey | FZABPMAKCGNVOU-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |