C18H19F3N4O4S — CID 127021720
(3aR,6aR)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127021720) has the molecular formula C18H19F3N4O4S and a molecular weight of 444.44 g/mol. Its IUPAC name is (3aR,6aR)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aR)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021720 |
| Molecular Formula | C18H19F3N4O4S |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (3aR,6aR)-5-pyrimidin-2-yl-N-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cccs1)[C@]12COC[C@H]1CN(c1ncccn1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H18N4O2S.C2HF3O2/c21-14(19-7-13-3-1-6-23-13)16-10-20(8-12(16)9-22-11-16)15-17-4-2-5-18-15;3-2(4,5)1(6)7/h1-6,12H,7-11H2,(H,19,21);(H,6,7)/t12-,16-;/m1./s1 |
| InChIKey | IQTJQGPPAIXTDU-VQZRABBESA-N |
| XLogP | 1.94 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |