C19H26FNO2S — CID 124783024
(7S)-2-[(2-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane (PubChem CID 124783024) has the molecular formula C19H26FNO2S and a molecular weight of 351.49 g/mol. Its IUPAC name is (7S)-2-[(2-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane.
| Compound Name | (7S)-2-[(2-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124783024 |
| Molecular Formula | C19H26FNO2S |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (7S)-2-[(2-fluorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane |
| SMILES | Fc1ccccc1CN1CC2(C[C@H](OCC3CCOCC3)CS2)C1 |
| InChI | InChI=1S/C19H26FNO2S/c20-18-4-2-1-3-16(18)10-21-13-19(14-21)9-17(12-24-19)23-11-15-5-7-22-8-6-15/h1-4,15,17H,5-14H2/t17-/m0/s1 |
| InChIKey | LJBALSGBSMVZGV-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |