C19H26ClNO2S — CID 131677612
2-[(3-chlorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane (PubChem CID 131677612) has the molecular formula C19H26ClNO2S and a molecular weight of 367.94 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane.
| Compound Name | 2-[(3-chlorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 131677612 |
| Molecular Formula | C19H26ClNO2S |
| Molecular Weight | 367.94 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-7-(oxan-4-ylmethoxy)-5-thia-2-azaspiro[3.4]octane |
| SMILES | Clc1cccc(CN2CC3(CC(OCC4CCOCC4)CS3)C2)c1 |
| InChI | InChI=1S/C19H26ClNO2S/c20-17-3-1-2-16(8-17)10-21-13-19(14-21)9-18(12-24-19)23-11-15-4-6-22-7-5-15/h1-3,8,15,18H,4-7,9-14H2 |
| InChIKey | VDHIIPZQDFVJPP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.94 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |