C15H23N3OS — CID 131663709
7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-5-thia-2-azaspiro[3.4]octane (PubChem CID 131663709) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-5-thia-2-azaspiro[3.4]octane.
| Compound Name | 7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-5-thia-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 131663709 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 7-(cyclopropylmethoxy)-2-[(1-methylpyrazol-4-yl)methyl]-5-thia-2-azaspiro[3.4]octane |
| SMILES | Cn1cc(CN2CC3(CC(OCC4CC4)CS3)C2)cn1 |
| InChI | InChI=1S/C15H23N3OS/c1-17-6-13(5-16-17)7-18-10-15(11-18)4-14(9-20-15)19-8-12-2-3-12/h5-6,12,14H,2-4,7-11H2,1H3 |
| InChIKey | DBPVRUMSNTZMNF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |