C16H18Cl2N2O — CID 124785469
3,6-dichloro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]pyridine-2-carboxamide (PubChem CID 124785469) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 3,6-dichloro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124785469 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3,6-dichloro-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@H]21)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c17-12-4-5-14(18)20-15(12)16(21)19-13-7-8-6-11(13)10-3-1-2-9(8)10/h4-5,8-11,13H,1-3,6-7H2,(H,19,21)/t8-,9-,10-,11+,13-/m1/s1 |
| InChIKey | BXBYAUZULNCBMQ-ZZBQETCWSA-N |
| XLogP | 3.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|