C17H23N3O2 — CID 124906365
5,6-dimethyl-2-oxo-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]-1H-pyrazine-3-carboxamide (PubChem CID 124906365) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5,6-dimethyl-2-oxo-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]-1H-pyrazine-3-carboxamide.
| Compound Name | 5,6-dimethyl-2-oxo-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 124906365 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 5,6-dimethyl-2-oxo-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]-1H-pyrazine-3-carboxamide |
| SMILES | Cc1nc(C(=O)N[C@@H]2C[C@H]3C[C@H]2[C@@H]2CCC[C@H]32)c(=O)[nH]c1C |
| InChI | InChI=1S/C17H23N3O2/c1-8-9(2)19-16(21)15(18-8)17(22)20-14-7-10-6-13(14)12-5-3-4-11(10)12/h10-14H,3-7H2,1-2H3,(H,19,21)(H,20,22)/t10-,11-,12-,13+,14-/m1/s1 |
| InChIKey | VYRIZYMLVDOHMJ-XGFWRYKXSA-N |
| XLogP | 1.94 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |