C17H16F3NO3 — CID 124786608
(3aR,7aR)-2-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 124786608) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124786608 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3aR,7aR)-2-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1C[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO3/c18-17(19,20)11-7-5-10(6-8-11)14(22)9-21-15(23)12-3-1-2-4-13(12)16(21)24/h1-2,5-8,12-14,22H,3-4,9H2/t12-,13-,14+/m1/s1 |
| InChIKey | XRUKPBJHNJPGDG-MCIONIFRSA-N |
| XLogP | 2.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|