C16H17F3N2O3 — CID 94385279
(5R)-5-cyclopropyl-3-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 94385279) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is (5R)-5-cyclopropyl-3-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-cyclopropyl-3-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94385279 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (5R)-5-cyclopropyl-3-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(C2CC2)NC(=O)N(C[C@H](O)c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C16H17F3N2O3/c1-15(10-6-7-10)13(23)21(14(24)20-15)8-12(22)9-2-4-11(5-3-9)16(17,18)19/h2-5,10,12,22H,6-8H2,1H3,(H,20,24)/t12-,15+/m0/s1 |
| InChIKey | OCLISMMDNIIGSA-SWLSCSKDSA-N |
| XLogP | 2.46 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|