C16H19F3N2O3 — CID 51086545
5,5-diethyl-3-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]imidazolidine-2,4-dione (PubChem CID 51086545) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 5,5-diethyl-3-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51086545 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5,5-diethyl-3-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(CC(O)c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C16H19F3N2O3/c1-3-15(4-2)13(23)21(14(24)20-15)9-12(22)10-6-5-7-11(8-10)16(17,18)19/h5-8,12,22H,3-4,9H2,1-2H3,(H,20,24) |
| InChIKey | XRFYCBOJBJNHIY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|