C16H19N3O3 — CID 124787865
[(4aR,7S,7aR)-7-(imidazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone (PubChem CID 124787865) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is [(4aR,7S,7aR)-7-(imidazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone.
| Compound Name | [(4aR,7S,7aR)-7-(imidazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 124787865 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [(4aR,7S,7aR)-7-(imidazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCO[C@@H]2[C@H](Cn3ccnc3)CC[C@H]21 |
| InChI | InChI=1S/C16H19N3O3/c20-16(14-2-1-8-21-14)19-7-9-22-15-12(3-4-13(15)19)10-18-6-5-17-11-18/h1-2,5-6,8,11-13,15H,3-4,7,9-10H2/t12-,13+,15+/m0/s1 |
| InChIKey | GCQLMOKMECMKOJ-GZBFAFLISA-N |
| XLogP | 1.80 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |