C15H23N5O2 — CID 124520949
[(4aR,7S,7aR)-7-(1,2,4-triazol-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 124520949) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is [(4aR,7S,7aR)-7-(1,2,4-triazol-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4aR,7S,7aR)-7-(1,2,4-triazol-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 124520949 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | [(4aR,7S,7aR)-7-(1,2,4-triazol-4-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(N1CCCC1)N1CCO[C@@H]2[C@H](Cn3cnnc3)CC[C@H]21 |
| InChI | InChI=1S/C15H23N5O2/c21-15(19-5-1-2-6-19)20-7-8-22-14-12(3-4-13(14)20)9-18-10-16-17-11-18/h10-14H,1-9H2/t12-,13+,14+/m0/s1 |
| InChIKey | VVQUGJIQQPKRHR-BFHYXJOUSA-N |
| XLogP | 0.97 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |