C12H21NO4 — CID 155875992
2-methoxy-1-[7-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone (PubChem CID 155875992) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-methoxy-1-[7-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone.
| Compound Name | 2-methoxy-1-[7-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone |
|---|---|
| PubChem CID | 155875992 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-methoxy-1-[7-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]ethanone |
| SMILES | COCC(=O)N1CCOC2C(COC)CCC21 |
| InChI | InChI=1S/C12H21NO4/c1-15-7-9-3-4-10-12(9)17-6-5-13(10)11(14)8-16-2/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | FBWXSQRDPIGPFP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |