C17H19N3O4 — CID 124788167
[(2R,3aR,7aR)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone (PubChem CID 124788167) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is [(2R,3aR,7aR)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone.
| Compound Name | [(2R,3aR,7aR)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 124788167 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [(2R,3aR,7aR)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(furan-3-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CC[C@@H]2C[C@H](c3nnc(C4CC4)o3)O[C@H]2C1 |
| InChI | InChI=1S/C17H19N3O4/c21-17(12-4-6-22-9-12)20-5-3-11-7-13(23-14(11)8-20)16-19-18-15(24-16)10-1-2-10/h4,6,9-11,13-14H,1-3,5,7-8H2/t11-,13-,14+/m1/s1 |
| InChIKey | ATMAYVLFZQXKDG-BNOWGMLFSA-N |
| XLogP | 2.53 |
| TPSA | 81.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |